Template:Infobox mineral/doc

This template is used on pages about minerals as well as gemstones to provide handy easy to access data about that mineral.

Usage

Most field names are in lowercase.

Copy a blank version to use. Please delete any unused fields to avoid clutter in the edit window.

Ruby
A naturally occurring ruby crystal
General
Category	Mineral variety
Formula (repeating unit)	aluminium oxide with chromium, Al2O3:Cr
Crystal system	Trigonal
Crystal class	Hexagonal scalenohedral (3m) H-M symbol: (3 2/m)
Space group	R3c (No. 167)
Unit cell	unit cell
Identification
Color	Red, may be brownish, purplish or pinkish
Crystal habit	Varies with locality. Terminated tabular hexagonal prisms.
Cleavage	No true cleavage
Fracture	Uneven or conchoidal
Mohs scale hardness	9.0
Luster	Vitreous
Streak	white
Diaphaneity	transparent
Specific gravity	4.0
Refractive index	nω=1.768 - 1.772 nε=1.760 - 1.763, Birefringence 0.008
Pleochroism	Orangey red, purplish red
Ultraviolet fluorescence	red under longwave
Melting point	2044 °C
Solubility	none
Major varieties
Sapphire	Any color except red and violet
Oriental amethyst	violet color
Corundum	various colors (mineral species)
Emery	Granular (mineral mixture)

{{Infobox mineral
| name        = 
| boxwidth    = 
| boxbgcolor  = 
| image       = 
| imagesize   = 
| alt         = 
| caption     = 
| struct image     =
| struct caption   =
| struct imagesize =
| struct2 image    =
| struct2 caption  =
| struct2 imagesize=
| SMILES           =
| Jmol             =
| category    = 
| formula     = 
| molweight   = 
| strunz      = 
| dana        = 
| system      = 
| class       = 
| symmetry    = 
| unit cell   = 
| color       = 
| colour      = 
| habit       = 
| twinning    = 
| cleavage    = 
| fracture    = 
| tenacity    = 
| toughness   = 
| mohs        = 
| luster      = 
| streak      = 
| diaphaneity = 
| gravity     = 
| density     = 
| polish      = 
| opticalprop = 
| refractive  = 
| birefringence = 
| pleochroism = 
| 2V          = 
| dispersion  = 
| extinction  = 
| length fast/slow =
| fluorescence = 
| absorption  = 
| melt        = 
| Curie temp  = 
| fusibility  = 
| diagnostic  = 
| solubility  = 
| impurities  = 
| alteration  = 
| other       = 
| prop1       = 
| prop1text   = 
| references  = 
| var1        = 
| var1text    = 
| var2        = 
| var2text    = 
| var3        = 
| var3text    = 
| var4        = 
| var4text    = 
| var5        = 
| var5text    = 
| var6        = 
| var6text    = 
}}

All parameters used

name
caption
General
Category	category
Formula (repeating unit)	formula
Strunz classification	strunz
Dana classification	dana
Crystal system	system
Crystal class	class
Space group	symmetry
Unit cell	unit cell
Structure
Crystal structure of α-tridymite
File:Diamond lattice.stl Some other image
Jmol (3D)	Interactive image
Identification
Formula mass	molweight
Colour	colorcolour
Crystal habit	habit
Twinning	twinning
Cleavage	cleavage
Fracture	fracture
Tenacity	tenacity
Mohs scale hardness	mohs
Lustre	luster
Streak	streak
Diaphaneity	diaphaneity
Specific gravity	gravity
Density	density
Polish lustre	polish
Optical properties	opticalprop
Refractive index	refractive
Birefringence	birefringence
Pleochroism	pleochroism
2V angle	2V
Dispersion	dispersion
Extinction	extinction
Length fast/slow	length fast/slow
Ultraviolet fluorescence	fluorescence
Absorption spectra	absorption
Melting point	melt
Fusibility	fusibility
Diagnostic features	diagnostic
Solubility	solubility
Common impurities	impurities
Alters to	alteration
Other characteristics	other
prop1	prop1text
References	references
Major varieties
var1	var1text
var2	var2text
var3	var3text
var4	var4text
var5	var5text
var6	var6text

| image = Tridymite tabulars - Ochtendung, Eifel, Germany.jpg
| imagesize   = 260px

|struct image=a-tridymite.png
|struct caption=Crystal structure of α-tridymite
|struct imagesize=150px
|struct2 image=Diamond lattice.stl
|struct2 caption=Some other image
|struct2 imagesize=200px

|SMILES = O[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4
|Jmol= C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O<!-- different so will show difgferent struct - to test -->
|boxbgcolor = yellow

| 2V = 2V
| absorption = absorption
| alt = alt
| alteration = alteration
| birefringence = birefringence
| boxtextcolor = boxtextcolor
| boxwidth = boxwidth
| caption = caption
| category = category
| class = class
| cleavage = cleavage
| color = color
| colour = colour
| dana = dana
| density = density
| diagnostic = diagnostic
| diaphaneity = diaphaneity
| dispersion = dispersion
| extinction = extinction
| fluorescence = fluorescence
| formula = formula
| fracture = fracture
| fusibility = fusibility
| gravity = gravity
| habit = habit
| impurities = impurities
| length fast/slow = length fast/slow
| luster = luster
| lustre = lustre
| melt = melt
| mohs = mohs
| molweight = molweight
| name = name
| opticalprop = opticalprop
| other = other
| pleochroism = pleochroism
| polish = polish
| polish lustre = polish lustre
| prop1 = prop1
| prop1text = prop1text
| references = references
| refractive = refractive
| solubility = solubility
| streak = streak
| strunz = strunz
| symmetry = symmetry
| system = system
| tenacity = tenacity
| twinning = twinning
| unit cell = unit cell
| var1 = var1
| var1text = var1text
| var2 = var2
| var2text = var2text
| var3 = var3
| var3text = var3text
| var4 = var4
| var4text = var4text
| var5 = var5
| var5text = var5text
| var6 = var6
| var6text = var6text

Description

This should describe the parameters used in this template.

Parameter	Explanation	Example
name	IMA mineral name (if there is another common name, put it in parentheses)	Baryte (Barite)
boxwidth
boxbgcolor	Background color of box headers
boxtextcolor	Text color of box headers
image	Wikimedia Commons image filename (to go at top)	Epidoto.jpeg
imagesize
alt	alt text for image, for visually impaired readers; see WP:ALT	Agglomeration of dark cylindrical crystals
caption	image caption	Epidote crystals
category	broad group then subgroup then sub-subgroup (if applicable) template does not auto-link	Sulfate minerals, Barite group
formula	chemical formula giving the elemental composition of a repeating unit of an alloy, a polymer, a crystal structure, a chain, or a network	BaSO4
strunz	Nickel-Strunz classification of the mineral (10 ed, MinDat)	9.BG.05
dana	Dana classification of the mineral	28.03.01.01
symmetry	Hermann–Mauguin notation of the mineral's symmetry element, labeled: Space group
unit cell	Unit cell dimensions and number (Z) of formula units per unit cell
molweight	molar mass of the chemical formula above
color	common colors of the mineral
colour	same as above, but for British pages
habit	common mineral habit
system	crystal system (cubic, etc.)
class	crystal class
twinning	common type of twinning
cleavage	type of cleavage
fracture	type of fracture (appearance of broken surface)	irregular
tenacity	tenacity (how the mineral can deform or break)	brittle
toughness	toughness (quantitative resistance to deformation or breakage)
mohs	hardness (scratchability) of mineral on Mohs hardness scale	3-3.5
luster	way the mineral reflects light, see luster
lustre	same as above, but for British pages
streak	see streak
diaphaneity	transparency of mineral
gravity	specific gravity
density	density at STP in g/cm3
polish	ability to take a polish
opticalprop
refractive	refractive index of mineral
birefringence	birefringence of a 30micron thin section
pleochroism	see pleochroism
2V	2V angle
dispersion	see dispersion
extinction	extinction angle, e.g. "parallel", or "inclined" and a quantitative angle. Irrelevant for minerals without an extinction angle (isotropic, opaque, or amorphous minerals).
length fast/slow	Sign of elongation: length fast or length slow
fluorescence	see fluorescence
absorption	see absorption
melt	melting point of mineral
Curie	Curie temperature of mineral
fusibility	fusibility of mineral
diagnostic	key way to recognize mineral
solubility	solubility of mineral in water at STP
impurities	common impurities
alteration	alteration products
other
prop1
prop1text
references	use the Wikipedia template:ref to cite	References supporting the properties to be added at that line using <ref>...</ref> tag notation. Individual items can be tagged separately if needed.
var1
var1text
var2
var2text
var3
var3text
var4
var4text
var5
var5text
var6
var6text

TemplateData

This is the TemplateData for this template used by TemplateWizard, VisualEditor and other tools. Click here to see a monthly parameter usage report for this template based on this TemplateData.

TemplateData for Infobox mineral

<templatedata> { "params": { "boxwidth": {}, "boxtextcolor": {}, "boxbgcolor": {}, "name": {}, "image": {}, "imagesize": {}, "alt": {}, "caption": {}, "category": {}, "formula": {}, "strunz": {}, "system": {}, "dana": {}, "class": {}, "symmetry": {}, "unit cell": {}, "molweight": {}, "color": {}, "habit": {}, "twinning": {}, "cleavage": {}, "fracture": {}, "tenacity": {}, "mohs": {}, "luster": {}, "polish": {}, "opticalprop": {}, "refractive": {}, "birefringence": {}, "pleochroism": {}, "2V": {}, "dispersion": {}, "extinction": {}, "length fast/slow": {}, "fluorescence": {}, "absorption": {}, "streak": {}, "gravity": {}, "density": {}, "melt": {}, "fusibility": {}, "diagnostic": {}, "solubility": {}, "diaphaneity": {}, "impurities": {}, "alteration": {}, "other": {}, "prop1text": {}, "references": {}, "colour": {}, "lustre": {}, "polish lustre": {}, "prop1": {}, "var1": {}, "var1text": {}, "var2": {}, "var2text": {}, "var3": {}, "var3text": {}, "var4": {}, "var4text": {}, "var5": {}, "var5text": {}, "var6": {}, "var6text": {}, "struct image": {}, "struct2 image": {}, "SMILES": {}, "Jmol": {}, "struct imagesize": {}, "struct alt": {}, "struct caption": {}, "struct2 imagesize": {}, "struct2 alt": {}, "struct2 caption": {} }, "paramOrder": [ "boxwidth", "boxtextcolor", "boxbgcolor", "name", "image", "imagesize", "alt", "caption", "category", "formula", "strunz", "system", "dana", "class", "symmetry", "unit cell", "molweight", "color", "habit", "twinning", "cleavage", "fracture", "tenacity", "mohs", "luster", "polish", "opticalprop", "refractive", "birefringence", "pleochroism", "2V", "dispersion", "extinction", "length fast/slow", "fluorescence", "absorption", "streak", "gravity", "density", "melt", "fusibility", "diagnostic", "solubility", "diaphaneity", "impurities", "alteration", "other", "prop1text", "references", "colour", "lustre", "polish lustre", "prop1", "var1", "var1text", "var2", "var2text", "var3", "var3text", "var4", "var4text", "var5", "var5text", "var6", "var6text", "struct image", "struct2 image", "struct caption", "struct imagesize", "struct alt", "struct2 imagesize", "struct2 caption", "struct2 alt", "Jmol", "SMILES" ] } </templatedata>

Tracking category

• Category:Pages using Infobox mineral with unknown parameters (0)